About (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate
(5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate (PubChem CID 75500394) has the molecular formula C16H15FN2O3S
and a molecular weight of 334.37 g/mol. Its IUPAC name is (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 75500394 |
| Molecular Formula | C16H15FN2O3S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate |
| SMILES | O=C1CCC(COC(=O)c2csc(Cc3cccc(F)c3)n2)N1 |
| InChI | InChI=1S/C16H15FN2O3S/c17-11-3-1-2-10(6-11)7-15-19-13(9-23-15)16(21)22-8-12-4-5-14(20)18-12/h1-3,6,9,12H,4-5,7-8H2,(H,18,20) |
| InChIKey | NLDHHBSMHNNUMW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate (CID 75500394) is (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate is O=C1CCC(COC(=O)c2csc(Cc3cccc(F)c3)n2)N1.
What is the InChIKey of (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate?
The InChIKey is NLDHHBSMHNNUMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2O3S/c17-11-3-1-2-10(6-11)7-15-19-13(9-23-15)16(21)22-8-12-4-5-14(20)18-12/h1-3,6,9,12H,4-5,7-8H2,(H,18,20).
What are the key properties of (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate?
(5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate has a molecular weight of 334.37 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxopyrrolidin-2-yl)methyl 2-[(3-fluorophenyl)methyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 75500394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).