C11H8F3N3OS — CID 75500898
N-[2-(3,4,5-trifluorophenyl)ethyl]thiadiazole-4-carboxamide (PubChem CID 75500898) has the molecular formula C11H8F3N3OS and a molecular weight of 287.27 g/mol. Its IUPAC name is N-[2-(3,4,5-trifluorophenyl)ethyl]thiadiazole-4-carboxamide.
| Compound Name | N-[2-(3,4,5-trifluorophenyl)ethyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 75500898 |
| Molecular Formula | C11H8F3N3OS |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-[2-(3,4,5-trifluorophenyl)ethyl]thiadiazole-4-carboxamide |
| SMILES | O=C(NCCc1cc(F)c(F)c(F)c1)c1csnn1 |
| InChI | InChI=1S/C11H8F3N3OS/c12-7-3-6(4-8(13)10(7)14)1-2-15-11(18)9-5-19-17-16-9/h3-5H,1-2H2,(H,15,18) |
| InChIKey | GQRXBBWCTYFDQC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|