About methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate
methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate (PubChem CID 75501528) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate.
Analyze methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate?
The IUPAC name of methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate (CID 75501528) is methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate.
What is the SMILES notation for methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate?
The canonical SMILES for methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate is COC(=O)C(C)(C)CNCc1cscn1.
What is the InChIKey of methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate?
The InChIKey is NDABWDTXMLCLMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-10(2,9(13)14-3)6-11-4-8-5-15-7-12-8/h5,7,11H,4,6H2,1-3H3.
What are the key properties of methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate?
methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate has a molecular weight of 228.32 g/mol, XLogP of 1.43, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-3-(1,3-thiazol-4-ylmethylamino)propanoate is sourced from PubChem (CID 75501528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).