C19H19NO3S2 — CID 7550289
[2-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 7550289) has the molecular formula C19H19NO3S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is [2-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [2-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 7550289 |
| Molecular Formula | C19H19NO3S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | [2-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | C[C@H]1CCN(C(=O)COC(=O)/C=C/c2ccsc2)c2ccccc2S1 |
| InChI | InChI=1S/C19H19NO3S2/c1-14-8-10-20(16-4-2-3-5-17(16)25-14)18(21)12-23-19(22)7-6-15-9-11-24-13-15/h2-7,9,11,13-14H,8,10,12H2,1H3/b7-6+/t14-/m0/s1 |
| InChIKey | CWJKGMWQTJQYAU-UZYOAWRESA-N |
| XLogP | 4.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|