C21H20ClNO3S — CID 7787121
[2-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 7787121) has the molecular formula C21H20ClNO3S and a molecular weight of 401.92 g/mol. Its IUPAC name is [2-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7787121 |
| Molecular Formula | C21H20ClNO3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | [2-[(2S)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | C[C@H]1CCN(C(=O)COC(=O)/C=C/c2cccc(Cl)c2)c2ccccc2S1 |
| InChI | InChI=1S/C21H20ClNO3S/c1-15-11-12-23(18-7-2-3-8-19(18)27-15)20(24)14-26-21(25)10-9-16-5-4-6-17(22)13-16/h2-10,13,15H,11-12,14H2,1H3/b10-9+/t15-/m0/s1 |
| InChIKey | CPQULNYWLPGYLV-FEAKQIBJSA-N |
| XLogP | 4.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|