About 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol
3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol (PubChem CID 75503244) has the molecular formula C20H29N3O
and a molecular weight of 327.47 g/mol. Its IUPAC name is 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol |
| PubChem CID | 75503244 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol |
| SMILES | Cc1nc2ccccc2c(N2CCC(N(C)CCCO)CC2)c1C |
| InChI | InChI=1S/C20H29N3O/c1-15-16(2)21-19-8-5-4-7-18(19)20(15)23-12-9-17(10-13-23)22(3)11-6-14-24/h4-5,7-8,17,24H,6,9-14H2,1-3H3 |
| InChIKey | OWDLAVHVMUCEDZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol?
The IUPAC name of 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol (CID 75503244) is 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol.
What is the SMILES notation for 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol?
The canonical SMILES for 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol is Cc1nc2ccccc2c(N2CCC(N(C)CCCO)CC2)c1C.
What is the InChIKey of 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol?
The InChIKey is OWDLAVHVMUCEDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3O/c1-15-16(2)21-19-8-5-4-7-18(19)20(15)23-12-9-17(10-13-23)22(3)11-6-14-24/h4-5,7-8,17,24H,6,9-14H2,1-3H3.
What are the key properties of 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol?
3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol has a molecular weight of 327.47 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(2,3-dimethylquinolin-4-yl)piperidin-4-yl]-methylamino]propan-1-ol is sourced from PubChem (CID 75503244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).