C13H11N3OS3 — CID 75505949
5-(4-methyl-1,3-thiazol-2-yl)-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 75505949) has the molecular formula C13H11N3OS3 and a molecular weight of 321.45 g/mol. Its IUPAC name is 5-(4-methyl-1,3-thiazol-2-yl)-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-(4-methyl-1,3-thiazol-2-yl)-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 75505949 |
| Molecular Formula | C13H11N3OS3 |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5-(4-methyl-1,3-thiazol-2-yl)-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | Cc1csc(-c2nc3sc4c(c3c(=O)[nH]2)CCSC4)n1 |
| InChI | InChI=1S/C13H11N3OS3/c1-6-4-19-13(14-6)10-15-11(17)9-7-2-3-18-5-8(7)20-12(9)16-10/h4H,2-3,5H2,1H3,(H,15,16,17) |
| InChIKey | PDEVEGZOSZEWCN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |