C12H14IN3OS — CID 137016841
4-tert-butyl-5-iodo-2-(4-methyl-1,3-thiazol-2-yl)-1H-pyrimidin-6-one (PubChem CID 137016841) has the molecular formula C12H14IN3OS and a molecular weight of 375.24 g/mol. Its IUPAC name is 4-tert-butyl-5-iodo-2-(4-methyl-1,3-thiazol-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-tert-butyl-5-iodo-2-(4-methyl-1,3-thiazol-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137016841 |
| Molecular Formula | C12H14IN3OS |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 4-tert-butyl-5-iodo-2-(4-methyl-1,3-thiazol-2-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1csc(-c2nc(C(C)(C)C)c(I)c(=O)[nH]2)n1 |
| InChI | InChI=1S/C12H14IN3OS/c1-6-5-18-11(14-6)9-15-8(12(2,3)4)7(13)10(17)16-9/h5H,1-4H3,(H,15,16,17) |
| InChIKey | RONZTRLUDQWRME-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|