C14H10IN3OS — CID 136739044
5-iodo-2-(4-methyl-1,3-thiazol-2-yl)-4-phenyl-1H-pyrimidin-6-one (PubChem CID 136739044) has the molecular formula C14H10IN3OS and a molecular weight of 395.23 g/mol. Its IUPAC name is 5-iodo-2-(4-methyl-1,3-thiazol-2-yl)-4-phenyl-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-2-(4-methyl-1,3-thiazol-2-yl)-4-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136739044 |
| Molecular Formula | C14H10IN3OS |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 5-iodo-2-(4-methyl-1,3-thiazol-2-yl)-4-phenyl-1H-pyrimidin-6-one |
| SMILES | Cc1csc(-c2nc(-c3ccccc3)c(I)c(=O)[nH]2)n1 |
| InChI | InChI=1S/C14H10IN3OS/c1-8-7-20-14(16-8)12-17-11(10(15)13(19)18-12)9-5-3-2-4-6-9/h2-7H,1H3,(H,17,18,19) |
| InChIKey | FPVCJJGPRWOEDZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|