C15H15N5O2S — CID 75506023
N-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 75506023) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 75506023 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1nc2ncnn2c(NC2CS(=O)(=O)c3ccccc32)c1C |
| InChI | InChI=1S/C15H15N5O2S/c1-9-10(2)18-15-16-8-17-20(15)14(9)19-12-7-23(21,22)13-6-4-3-5-11(12)13/h3-6,8,12,19H,7H2,1-2H3 |
| InChIKey | JACNZYYGOIWWJN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |