C11H16N2O2S — CID 75506194
5-ethyl-N-(2-hydroxyethyl)-N-prop-2-enyl-1,3-thiazole-2-carboxamide (PubChem CID 75506194) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 5-ethyl-N-(2-hydroxyethyl)-N-prop-2-enyl-1,3-thiazole-2-carboxamide.
| Compound Name | 5-ethyl-N-(2-hydroxyethyl)-N-prop-2-enyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 75506194 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 5-ethyl-N-(2-hydroxyethyl)-N-prop-2-enyl-1,3-thiazole-2-carboxamide |
| SMILES | C=CCN(CCO)C(=O)c1ncc(CC)s1 |
| InChI | InChI=1S/C11H16N2O2S/c1-3-5-13(6-7-14)11(15)10-12-8-9(4-2)16-10/h3,8,14H,1,4-7H2,2H3 |
| InChIKey | SADUWQIHAQAMLW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|