C11H12N4OS — CID 75506471
N-(5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiophene-3-carboxamide (PubChem CID 75506471) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is N-(5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiophene-3-carboxamide.
| Compound Name | N-(5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 75506471 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-(5-cyclobutyl-1H-1,2,4-triazol-3-yl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1n[nH]c(C2CCC2)n1)c1ccsc1 |
| InChI | InChI=1S/C11H12N4OS/c16-10(8-4-5-17-6-8)13-11-12-9(14-15-11)7-2-1-3-7/h4-7H,1-3H2,(H2,12,13,14,15,16) |
| InChIKey | WFWCPZPLJVYAFB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |