C15H12N4O4 — CID 75507851
N-(2-methyl-6-nitroquinolin-4-yl)-2-(1,2-oxazol-3-yl)acetamide (PubChem CID 75507851) has the molecular formula C15H12N4O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is N-(2-methyl-6-nitroquinolin-4-yl)-2-(1,2-oxazol-3-yl)acetamide.
| Compound Name | N-(2-methyl-6-nitroquinolin-4-yl)-2-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 75507851 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-(2-methyl-6-nitroquinolin-4-yl)-2-(1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)Cc2ccon2)c2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C15H12N4O4/c1-9-6-14(17-15(20)7-10-4-5-23-18-10)12-8-11(19(21)22)2-3-13(12)16-9/h2-6,8H,7H2,1H3,(H,16,17,20) |
| InChIKey | CWOSKNCAVKCBLC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|