C17H16N4O4 — CID 75507854
N-(2-methyl-6-nitroquinolin-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 75507854) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is N-(2-methyl-6-nitroquinolin-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2-methyl-6-nitroquinolin-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 75507854 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-(2-methyl-6-nitroquinolin-4-yl)-5-propan-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ncoc2C(C)C)c2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C17H16N4O4/c1-9(2)16-15(18-8-25-16)17(22)20-14-6-10(3)19-13-5-4-11(21(23)24)7-12(13)14/h4-9H,1-3H3,(H,19,20,22) |
| InChIKey | KAVWYGRRTCAQSR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|