C14H16N4OS — CID 75509675
N-methyl-4-[[(6-methylsulfanylpyrazin-2-yl)amino]methyl]benzamide (PubChem CID 75509675) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is N-methyl-4-[[(6-methylsulfanylpyrazin-2-yl)amino]methyl]benzamide.
| Compound Name | N-methyl-4-[[(6-methylsulfanylpyrazin-2-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 75509675 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-methyl-4-[[(6-methylsulfanylpyrazin-2-yl)amino]methyl]benzamide |
| SMILES | CNC(=O)c1ccc(CNc2cncc(SC)n2)cc1 |
| InChI | InChI=1S/C14H16N4OS/c1-15-14(19)11-5-3-10(4-6-11)7-17-12-8-16-9-13(18-12)20-2/h3-6,8-9H,7H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | LPJTWHGIMDDCNL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |