C16H23FN2O5 — CID 75510521
ethyl 3-[[3-fluoro-4-(2-methoxyethoxy)phenyl]carbamoyl-methylamino]propanoate (PubChem CID 75510521) has the molecular formula C16H23FN2O5 and a molecular weight of 342.37 g/mol. Its IUPAC name is ethyl 3-[[3-fluoro-4-(2-methoxyethoxy)phenyl]carbamoyl-methylamino]propanoate.
| Compound Name | ethyl 3-[[3-fluoro-4-(2-methoxyethoxy)phenyl]carbamoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 75510521 |
| Molecular Formula | C16H23FN2O5 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | ethyl 3-[[3-fluoro-4-(2-methoxyethoxy)phenyl]carbamoyl-methylamino]propanoate |
| SMILES | CCOC(=O)CCN(C)C(=O)Nc1ccc(OCCOC)c(F)c1 |
| InChI | InChI=1S/C16H23FN2O5/c1-4-23-15(20)7-8-19(2)16(21)18-12-5-6-14(13(17)11-12)24-10-9-22-3/h5-6,11H,4,7-10H2,1-3H3,(H,18,21) |
| InChIKey | OCXSZLJIRRTGDW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|