C13H12ClFN2O4S — CID 119052121
4-chloro-N-[3-fluoro-4-(2-methoxyethoxy)phenyl]-3-oxo-1,2-thiazole-5-carboxamide (PubChem CID 119052121) has the molecular formula C13H12ClFN2O4S and a molecular weight of 346.77 g/mol. Its IUPAC name is 4-chloro-N-[3-fluoro-4-(2-methoxyethoxy)phenyl]-3-oxo-1,2-thiazole-5-carboxamide.
| Compound Name | 4-chloro-N-[3-fluoro-4-(2-methoxyethoxy)phenyl]-3-oxo-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 119052121 |
| Molecular Formula | C13H12ClFN2O4S |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-chloro-N-[3-fluoro-4-(2-methoxyethoxy)phenyl]-3-oxo-1,2-thiazole-5-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)c2s[nH]c(=O)c2Cl)cc1F |
| InChI | InChI=1S/C13H12ClFN2O4S/c1-20-4-5-21-9-3-2-7(6-8(9)15)16-13(19)11-10(14)12(18)17-22-11/h2-3,6H,4-5H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | FNOTYSZIVILQKZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|