C19H31N5O — CID 75511967
N'-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]morpholine-4-carboximidamide (PubChem CID 75511967) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is N'-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]morpholine-4-carboximidamide.
| Compound Name | N'-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 75511967 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | N'-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]morpholine-4-carboximidamide |
| SMILES | Cc1cccc(N2CCN(CCC/N=C(\N)N3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C19H31N5O/c1-17-4-2-5-18(16-17)23-10-8-22(9-11-23)7-3-6-21-19(20)24-12-14-25-15-13-24/h2,4-5,16H,3,6-15H2,1H3,(H2,20,21) |
| InChIKey | FNTMHJQKDOKTTE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|