About 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide
3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide (PubChem CID 75512323) has the molecular formula C18H28N4O2
and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide.
Molecular Properties
| Compound Name | 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide |
| PubChem CID | 75512323 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide |
| SMILES | Cc1cc(N2CCCC(NC(=O)CCC3CCCC3)C2=O)n(C)n1 |
| InChI | InChI=1S/C18H28N4O2/c1-13-12-17(21(2)20-13)22-11-5-8-15(18(22)24)19-16(23)10-9-14-6-3-4-7-14/h12,14-15H,3-11H2,1-2H3,(H,19,23) |
| InChIKey | WMGQQDYWCYEDMU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide?
The IUPAC name of 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide (CID 75512323) is 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide.
What is the SMILES notation for 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide?
The canonical SMILES for 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide is Cc1cc(N2CCCC(NC(=O)CCC3CCCC3)C2=O)n(C)n1.
What is the InChIKey of 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide?
The InChIKey is WMGQQDYWCYEDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O2/c1-13-12-17(21(2)20-13)22-11-5-8-15(18(22)24)19-16(23)10-9-14-6-3-4-7-14/h12,14-15H,3-11H2,1-2H3,(H,19,23).
What are the key properties of 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide?
3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide has a molecular weight of 332.45 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-N-[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]propanamide is sourced from PubChem (CID 75512323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).