C14H12N2O4 — CID 75513414
(E)-3-[4-[[2-(1,2-oxazol-3-yl)acetyl]amino]phenyl]prop-2-enoic acid (PubChem CID 75513414) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is (E)-3-[4-[[2-(1,2-oxazol-3-yl)acetyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-(1,2-oxazol-3-yl)acetyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 75513414 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (E)-3-[4-[[2-(1,2-oxazol-3-yl)acetyl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(NC(=O)Cc2ccon2)cc1 |
| InChI | InChI=1S/C14H12N2O4/c17-13(9-12-7-8-20-16-12)15-11-4-1-10(2-5-11)3-6-14(18)19/h1-8H,9H2,(H,15,17)(H,18,19)/b6-3+ |
| InChIKey | IYKHNDVTNYSAKA-ZZXKWVIFSA-N |
| XLogP | 1.95 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|