About oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate
oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate (PubChem CID 75514514) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate |
| PubChem CID | 75514514 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate |
| SMILES | COCCC1(C(=O)OC2CCOCC2)CCC1 |
| InChI | InChI=1S/C13H22O4/c1-15-10-7-13(5-2-6-13)12(14)17-11-3-8-16-9-4-11/h11H,2-10H2,1H3 |
| InChIKey | IEJPTWWPRIYDIH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate?
The IUPAC name of oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate (CID 75514514) is oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate.
What is the SMILES notation for oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate?
The canonical SMILES for oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate is COCCC1(C(=O)OC2CCOCC2)CCC1.
What is the InChIKey of oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate?
The InChIKey is IEJPTWWPRIYDIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-15-10-7-13(5-2-6-13)12(14)17-11-3-8-16-9-4-11/h11H,2-10H2,1H3.
What are the key properties of oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate?
oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate has a molecular weight of 242.31 g/mol, XLogP of 1.92, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl 1-(2-methoxyethyl)cyclobutane-1-carboxylate is sourced from PubChem (CID 75514514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).