About 3-cyanopropyl 4-imidazol-1-ylbenzoate
3-cyanopropyl 4-imidazol-1-ylbenzoate (PubChem CID 75516132) has the molecular formula C14H13N3O2
and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-cyanopropyl 4-imidazol-1-ylbenzoate.
Molecular Properties
| Compound Name | 3-cyanopropyl 4-imidazol-1-ylbenzoate |
| PubChem CID | 75516132 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-cyanopropyl 4-imidazol-1-ylbenzoate |
| SMILES | N#CCCCOC(=O)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C14H13N3O2/c15-7-1-2-10-19-14(18)12-3-5-13(6-4-12)17-9-8-16-11-17/h3-6,8-9,11H,1-2,10H2 |
| InChIKey | CTRRLEHILLDZQY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyanopropyl 4-imidazol-1-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyanopropyl 4-imidazol-1-ylbenzoate?
The IUPAC name of 3-cyanopropyl 4-imidazol-1-ylbenzoate (CID 75516132) is 3-cyanopropyl 4-imidazol-1-ylbenzoate.
What is the SMILES notation for 3-cyanopropyl 4-imidazol-1-ylbenzoate?
The canonical SMILES for 3-cyanopropyl 4-imidazol-1-ylbenzoate is N#CCCCOC(=O)c1ccc(-n2ccnc2)cc1.
What is the InChIKey of 3-cyanopropyl 4-imidazol-1-ylbenzoate?
The InChIKey is CTRRLEHILLDZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c15-7-1-2-10-19-14(18)12-3-5-13(6-4-12)17-9-8-16-11-17/h3-6,8-9,11H,1-2,10H2.
What are the key properties of 3-cyanopropyl 4-imidazol-1-ylbenzoate?
3-cyanopropyl 4-imidazol-1-ylbenzoate has a molecular weight of 255.28 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyanopropyl 4-imidazol-1-ylbenzoate is sourced from PubChem (CID 75516132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).