C16H26N4O2 — CID 75518588
1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[2-(oxan-2-yl)ethyl]urea (PubChem CID 75518588) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[2-(oxan-2-yl)ethyl]urea.
| Compound Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[2-(oxan-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 75518588 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[2-(oxan-2-yl)ethyl]urea |
| SMILES | CN(C)c1cc(CNC(=O)NCCC2CCCCO2)ccn1 |
| InChI | InChI=1S/C16H26N4O2/c1-20(2)15-11-13(6-8-17-15)12-19-16(21)18-9-7-14-5-3-4-10-22-14/h6,8,11,14H,3-5,7,9-10,12H2,1-2H3,(H2,18,19,21) |
| InChIKey | ZSYKDCZYJXQUGP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |