C15H24N4OS — CID 97022306
1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea (PubChem CID 97022306) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea.
| Compound Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97022306 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[[(2R)-2-methylthiolan-2-yl]methyl]urea |
| SMILES | CN(C)c1cc(CNC(=O)NC[C@@]2(C)CCCS2)ccn1 |
| InChI | InChI=1S/C15H24N4OS/c1-15(6-4-8-21-15)11-18-14(20)17-10-12-5-7-16-13(9-12)19(2)3/h5,7,9H,4,6,8,10-11H2,1-3H3,(H2,17,18,20)/t15-/m1/s1 |
| InChIKey | VHCKXEGNXPOFDN-OAHLLOKOSA-N |
| XLogP | 2.23 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |