C17H21N5OS — CID 75519244
[6-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methanol (PubChem CID 75519244) has the molecular formula C17H21N5OS and a molecular weight of 343.46 g/mol. Its IUPAC name is [6-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methanol.
| Compound Name | [6-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methanol |
|---|---|
| PubChem CID | 75519244 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [6-[(5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)methylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methanol |
| SMILES | CC1(C)CCc2sc(CNc3ccc4nnc(CO)n4n3)cc2C1 |
| InChI | InChI=1S/C17H21N5OS/c1-17(2)6-5-13-11(8-17)7-12(24-13)9-18-14-3-4-15-19-20-16(10-23)22(15)21-14/h3-4,7,23H,5-6,8-10H2,1-2H3,(H,18,21) |
| InChIKey | UOMRXMSQSCURNN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |