C16H18N6O — CID 75520966
N-(1-cyclohexyl-1,2,4-triazol-3-yl)-3H-benzimidazole-5-carboxamide (PubChem CID 75520966) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is N-(1-cyclohexyl-1,2,4-triazol-3-yl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(1-cyclohexyl-1,2,4-triazol-3-yl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 75520966 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-(1-cyclohexyl-1,2,4-triazol-3-yl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ncn(C2CCCCC2)n1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H18N6O/c23-15(11-6-7-13-14(8-11)18-9-17-13)20-16-19-10-22(21-16)12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H,17,18)(H,20,21,23) |
| InChIKey | DZMVBMLFXXEYTF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |