C15H17N3OS — CID 75521460
3-[2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]ethoxy]benzonitrile (PubChem CID 75521460) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 3-[2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]ethoxy]benzonitrile.
| Compound Name | 3-[2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 75521460 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-[2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]ethoxy]benzonitrile |
| SMILES | Cc1csc(C(C)NCCOc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C15H17N3OS/c1-11-10-20-15(18-11)12(2)17-6-7-19-14-5-3-4-13(8-14)9-16/h3-5,8,10,12,17H,6-7H2,1-2H3 |
| InChIKey | OVDVKGRKUKKDEN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|