C17H28N2O3S — CID 75522596
1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-prop-2-enylpent-4-en-1-one (PubChem CID 75522596) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-prop-2-enylpent-4-en-1-one.
| Compound Name | 1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-prop-2-enylpent-4-en-1-one |
|---|---|
| PubChem CID | 75522596 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)piperidin-1-yl]-2-prop-2-enylpent-4-en-1-one |
| SMILES | C=CCC(CC=C)C(=O)N1CCC(N2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C17H28N2O3S/c1-3-5-15(6-4-2)17(20)19-9-7-16(8-10-19)18-11-13-23(21,22)14-12-18/h3-4,15-16H,1-2,5-14H2 |
| InChIKey | BRRSWRZLCWVZHF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|