C18H28N4O2 — CID 75523158
N-(2-methoxy-2-methylpropyl)-1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 75523158) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N-(2-methoxy-2-methylpropyl)-1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | N-(2-methoxy-2-methylpropyl)-1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 75523158 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N-(2-methoxy-2-methylpropyl)-1-pyrimidin-2-yl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | COC(C)(C)CNC(=O)C1CC2CCCCC2N1c1ncccn1 |
| InChI | InChI=1S/C18H28N4O2/c1-18(2,24-3)12-21-16(23)15-11-13-7-4-5-8-14(13)22(15)17-19-9-6-10-20-17/h6,9-10,13-15H,4-5,7-8,11-12H2,1-3H3,(H,21,23) |
| InChIKey | ABYYQPFASQBXDB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |