C19H26N2O2S — CID 75523575
(4-ethyl-5-propylthiophen-2-yl)-[3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone (PubChem CID 75523575) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is (4-ethyl-5-propylthiophen-2-yl)-[3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone.
| Compound Name | (4-ethyl-5-propylthiophen-2-yl)-[3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 75523575 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (4-ethyl-5-propylthiophen-2-yl)-[3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone |
| SMILES | CCCc1sc(C(=O)N2CCOCC2c2cccn2C)cc1CC |
| InChI | InChI=1S/C19H26N2O2S/c1-4-7-17-14(5-2)12-18(24-17)19(22)21-10-11-23-13-16(21)15-8-6-9-20(15)3/h6,8-9,12,16H,4-5,7,10-11,13H2,1-3H3 |
| InChIKey | QXJYIPIPFSORFW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |