C19H19ClN4O2S — CID 75527424
(4-chloro-2-methoxyphenyl)-[4-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperazin-1-yl]methanone (PubChem CID 75527424) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is (4-chloro-2-methoxyphenyl)-[4-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperazin-1-yl]methanone.
| Compound Name | (4-chloro-2-methoxyphenyl)-[4-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 75527424 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (4-chloro-2-methoxyphenyl)-[4-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperazin-1-yl]methanone |
| SMILES | COc1cc(Cl)ccc1C(=O)N1CCN(c2cc(-c3cccs3)[nH]n2)CC1 |
| InChI | InChI=1S/C19H19ClN4O2S/c1-26-16-11-13(20)4-5-14(16)19(25)24-8-6-23(7-9-24)18-12-15(21-22-18)17-3-2-10-27-17/h2-5,10-12H,6-9H2,1H3,(H,21,22) |
| InChIKey | GFDXKVSKXQCTGG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |