C20H22N4O2S — CID 75527408
(4-methoxy-2-methylphenyl)-[4-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperazin-1-yl]methanone (PubChem CID 75527408) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is (4-methoxy-2-methylphenyl)-[4-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperazin-1-yl]methanone.
| Compound Name | (4-methoxy-2-methylphenyl)-[4-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 75527408 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (4-methoxy-2-methylphenyl)-[4-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3cc(-c4cccs4)[nH]n3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H22N4O2S/c1-14-12-15(26-2)5-6-16(14)20(25)24-9-7-23(8-10-24)19-13-17(21-22-19)18-4-3-11-27-18/h3-6,11-13H,7-10H2,1-2H3,(H,21,22) |
| InChIKey | OVXBCZUWYAGRQE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |