C18H23N5O5 — CID 75528606
N-[(2,3-dimethoxyphenyl)methyl]-2-(7-ethyl-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)acetamide (PubChem CID 75528606) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2-(7-ethyl-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)acetamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2-(7-ethyl-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)acetamide |
|---|---|
| PubChem CID | 75528606 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2-(7-ethyl-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)acetamide |
| SMILES | CCN1CCn2c(nn(CC(=O)NCc3cccc(OC)c3OC)c2=O)C1=O |
| InChI | InChI=1S/C18H23N5O5/c1-4-21-8-9-22-16(17(21)25)20-23(18(22)26)11-14(24)19-10-12-6-5-7-13(27-2)15(12)28-3/h5-7H,4,8-11H2,1-3H3,(H,19,24) |
| InChIKey | ZWDZIZRNVJTTNZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |