C17H23N3O3 — CID 75529701
(2S)-N-benzyl-1-[3-(methylcarbamoyl)oxetan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 75529701) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S)-N-benzyl-1-[3-(methylcarbamoyl)oxetan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-benzyl-1-[3-(methylcarbamoyl)oxetan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 75529701 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S)-N-benzyl-1-[3-(methylcarbamoyl)oxetan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1(N2CCC[C@H]2C(=O)NCc2ccccc2)COC1 |
| InChI | InChI=1S/C17H23N3O3/c1-18-16(22)17(11-23-12-17)20-9-5-8-14(20)15(21)19-10-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3,(H,18,22)(H,19,21)/t14-/m0/s1 |
| InChIKey | FIOSBJFWKHPYBA-AWEZNQCLSA-N |
| XLogP | 0.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |