C18H29IN4OS — CID 75532729
1-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-prop-2-enyl-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 75532729) has the molecular formula C18H29IN4OS and a molecular weight of 476.43 g/mol. Its IUPAC name is 1-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-prop-2-enyl-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-prop-2-enyl-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 75532729 |
| Molecular Formula | C18H29IN4OS |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 1-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-prop-2-enyl-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1cccs1)NCCC(CC)N1CCCC1=O.I |
| InChI | InChI=1S/C18H28N4OS.HI/c1-3-10-19-18(21-14-16-7-6-13-24-16)20-11-9-15(4-2)22-12-5-8-17(22)23;/h3,6-7,13,15H,1,4-5,8-12,14H2,2H3,(H2,19,20,21);1H |
| InChIKey | VYDPBJVDXHISFD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|