C15H25N5 — CID 75533357
N-ethyl-4-methyl-N'-[(2-methylpyrimidin-4-yl)methyl]piperidine-1-carboximidamide (PubChem CID 75533357) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is N-ethyl-4-methyl-N'-[(2-methylpyrimidin-4-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-methyl-N'-[(2-methylpyrimidin-4-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 75533357 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | N-ethyl-4-methyl-N'-[(2-methylpyrimidin-4-yl)methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccnc(C)n1)N1CCC(C)CC1 |
| InChI | InChI=1S/C15H25N5/c1-4-16-15(20-9-6-12(2)7-10-20)18-11-14-5-8-17-13(3)19-14/h5,8,12H,4,6-7,9-11H2,1-3H3,(H,16,18) |
| InChIKey | TZMLKASPCQMEFN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|