C21H29FN2O3 — CID 75536258
(2R,3S,6S)-6-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-[(3-methylbutylamino)methyl]oxan-3-ol (PubChem CID 75536258) has the molecular formula C21H29FN2O3 and a molecular weight of 376.47 g/mol. Its IUPAC name is (2R,3S,6S)-6-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-[(3-methylbutylamino)methyl]oxan-3-ol.
| Compound Name | (2R,3S,6S)-6-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-[(3-methylbutylamino)methyl]oxan-3-ol |
|---|---|
| PubChem CID | 75536258 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (2R,3S,6S)-6-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-[(3-methylbutylamino)methyl]oxan-3-ol |
| SMILES | CC(C)CCNC[C@H]1O[C@H](Cc2cc(-c3ccc(F)cc3)on2)CC[C@@H]1O |
| InChI | InChI=1S/C21H29FN2O3/c1-14(2)9-10-23-13-21-19(25)8-7-18(26-21)11-17-12-20(27-24-17)15-3-5-16(22)6-4-15/h3-6,12,14,18-19,21,23,25H,7-11,13H2,1-2H3/t18-,19-,21+/m0/s1 |
| InChIKey | KTMILQMJXPTFQB-IRFCIJBXSA-N |
| XLogP | 3.57 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|