C21H29N3O3 — CID 75537134
(8aR)-2-cyclohexyl-7-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one (PubChem CID 75537134) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is (8aR)-2-cyclohexyl-7-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8aR)-2-cyclohexyl-7-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 75537134 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (8aR)-2-cyclohexyl-7-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1N(C2CCCCC2)C[C@H]2CN(Cc3ccc4c(c3)OCCO4)CCN12 |
| InChI | InChI=1S/C21H29N3O3/c25-21-23-9-8-22(13-16-6-7-19-20(12-16)27-11-10-26-19)14-18(23)15-24(21)17-4-2-1-3-5-17/h6-7,12,17-18H,1-5,8-11,13-15H2/t18-/m1/s1 |
| InChIKey | COLXJDOCVHXODE-GOSISDBHSA-N |
| XLogP | 2.71 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |