C30H45N5O3 — CID 75548170
N-cyclohexyl-2-[(2,5-dimethylphenyl)methyl]-4-(3-methylbutyl)-1,5-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazoline-8-carboxamide (PubChem CID 75548170) has the molecular formula C30H45N5O3 and a molecular weight of 523.72 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2,5-dimethylphenyl)methyl]-4-(3-methylbutyl)-1,5-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazoline-8-carboxamide.
| Compound Name | N-cyclohexyl-2-[(2,5-dimethylphenyl)methyl]-4-(3-methylbutyl)-1,5-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 75548170 |
| Molecular Formula | C30H45N5O3 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | N-cyclohexyl-2-[(2,5-dimethylphenyl)methyl]-4-(3-methylbutyl)-1,5-dioxo-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazoline-8-carboxamide |
| SMILES | Cc1ccc(C)c(CN2NC3N(CCC(C)C)C(=O)C4CCC(C(=O)NC5CCCCC5)CC4N3C2=O)c1 |
| InChI | InChI=1S/C30H45N5O3/c1-19(2)14-15-33-28(37)25-13-12-22(27(36)31-24-8-6-5-7-9-24)17-26(25)35-29(33)32-34(30(35)38)18-23-16-20(3)10-11-21(23)4/h10-11,16,19,22,24-26,29,32H,5-9,12-15,17-18H2,1-4H3,(H,31,36) |
| InChIKey | SETRRNPIEQNYLR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |