C26H29FN4O3 — CID 75974175
2-[2-(2,5-dimethylphenyl)-2-oxoethyl]-4-[(4-fluorophenyl)methyl]-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazoline-1,5-dione (PubChem CID 75974175) has the molecular formula C26H29FN4O3 and a molecular weight of 464.54 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphenyl)-2-oxoethyl]-4-[(4-fluorophenyl)methyl]-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazoline-1,5-dione.
| Compound Name | 2-[2-(2,5-dimethylphenyl)-2-oxoethyl]-4-[(4-fluorophenyl)methyl]-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazoline-1,5-dione |
|---|---|
| PubChem CID | 75974175 |
| Molecular Formula | C26H29FN4O3 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-[2-(2,5-dimethylphenyl)-2-oxoethyl]-4-[(4-fluorophenyl)methyl]-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazoline-1,5-dione |
| SMILES | Cc1ccc(C)c(C(=O)CN2NC3N(Cc4ccc(F)cc4)C(=O)C4CCCCC4N3C2=O)c1 |
| InChI | InChI=1S/C26H29FN4O3/c1-16-7-8-17(2)21(13-16)23(32)15-30-26(34)31-22-6-4-3-5-20(22)24(33)29(25(31)28-30)14-18-9-11-19(27)12-10-18/h7-13,20,22,25,28H,3-6,14-15H2,1-2H3 |
| InChIKey | DNZFPMKSPFZZDB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |