C22H21F2N5O3S — CID 75552351
N-(2,5-difluorophenyl)-2-[[7-(3-methoxyphenyl)-8-oxo-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]sulfanyl]butanamide (PubChem CID 75552351) has the molecular formula C22H21F2N5O3S and a molecular weight of 473.51 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-[[7-(3-methoxyphenyl)-8-oxo-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]sulfanyl]butanamide.
| Compound Name | N-(2,5-difluorophenyl)-2-[[7-(3-methoxyphenyl)-8-oxo-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 75552351 |
| Molecular Formula | C22H21F2N5O3S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-[[7-(3-methoxyphenyl)-8-oxo-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]sulfanyl]butanamide |
| SMILES | CCC(SC1=NNC2C(=O)N(c3cccc(OC)c3)C=CN12)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C22H21F2N5O3S/c1-3-18(20(30)25-17-11-13(23)7-8-16(17)24)33-22-27-26-19-21(31)28(9-10-29(19)22)14-5-4-6-15(12-14)32-2/h4-12,18-19,26H,3H2,1-2H3,(H,25,30) |
| InChIKey | KIGJLSTUHWVFBW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |