C23H23F2N5O3S — CID 75552224
N-(2,5-difluorophenyl)-2-[[7-(4-ethoxyphenyl)-8-oxo-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]sulfanyl]butanamide (PubChem CID 75552224) has the molecular formula C23H23F2N5O3S and a molecular weight of 487.53 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-[[7-(4-ethoxyphenyl)-8-oxo-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]sulfanyl]butanamide.
| Compound Name | N-(2,5-difluorophenyl)-2-[[7-(4-ethoxyphenyl)-8-oxo-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 75552224 |
| Molecular Formula | C23H23F2N5O3S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-[[7-(4-ethoxyphenyl)-8-oxo-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]sulfanyl]butanamide |
| SMILES | CCOc1ccc(N2C=CN3C(SC(CC)C(=O)Nc4cc(F)ccc4F)=NNC3C2=O)cc1 |
| InChI | InChI=1S/C23H23F2N5O3S/c1-3-19(21(31)26-18-13-14(24)5-10-17(18)25)34-23-28-27-20-22(32)29(11-12-30(20)23)15-6-8-16(9-7-15)33-4-2/h5-13,19-20,27H,3-4H2,1-2H3,(H,26,31) |
| InChIKey | XOZXGCUWDBMWOA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |