C20H21N3O5 — CID 7556124
N-(3,4-diethoxyphenyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]acetamide (PubChem CID 7556124) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]acetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 7556124 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-[4-(1,3,4-oxadiazol-2-yl)phenoxy]acetamide |
| SMILES | CCOc1ccc(NC(=O)COc2ccc(-c3nnco3)cc2)cc1OCC |
| InChI | InChI=1S/C20H21N3O5/c1-3-25-17-10-7-15(11-18(17)26-4-2)22-19(24)12-27-16-8-5-14(6-9-16)20-23-21-13-28-20/h5-11,13H,3-4,12H2,1-2H3,(H,22,24) |
| InChIKey | VUXPIQLGNWHSAX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |