C18H22N4O3 — CID 7556321
(4aS)-8-amino-1',3'-dimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione (PubChem CID 7556321) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is (4aS)-8-amino-1',3'-dimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione.
| Compound Name | (4aS)-8-amino-1',3'-dimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
|---|---|
| PubChem CID | 7556321 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (4aS)-8-amino-1',3'-dimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-diazinane]-2',4',6'-trione |
| SMILES | CN1C(=O)N(C)C(=O)C2(Cc3cc(N)ccc3N3CCCC[C@H]32)C1=O |
| InChI | InChI=1S/C18H22N4O3/c1-20-15(23)18(16(24)21(2)17(20)25)10-11-9-12(19)6-7-13(11)22-8-4-3-5-14(18)22/h6-7,9,14H,3-5,8,10,19H2,1-2H3/t14-/m0/s1 |
| InChIKey | OMKZOOMMQXSTQA-AWEZNQCLSA-N |
| XLogP | 1.22 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|