C19H23N3O5 — CID 7557682
[2-(azepan-1-yl)-2-oxoethyl] 3-(2-hydroxyethyl)-4-oxophthalazine-1-carboxylate (PubChem CID 7557682) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 3-(2-hydroxyethyl)-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 3-(2-hydroxyethyl)-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7557682 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 3-(2-hydroxyethyl)-4-oxophthalazine-1-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCCCC1)c1nn(CCO)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H23N3O5/c23-12-11-22-18(25)15-8-4-3-7-14(15)17(20-22)19(26)27-13-16(24)21-9-5-1-2-6-10-21/h3-4,7-8,23H,1-2,5-6,9-13H2 |
| InChIKey | JSZXJIUFKKQRQC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |