C19H18N2O4 — CID 7898412
(3-methylphenyl)methyl 3-(2-hydroxyethyl)-4-oxophthalazine-1-carboxylate (PubChem CID 7898412) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (3-methylphenyl)methyl 3-(2-hydroxyethyl)-4-oxophthalazine-1-carboxylate.
| Compound Name | (3-methylphenyl)methyl 3-(2-hydroxyethyl)-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7898412 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (3-methylphenyl)methyl 3-(2-hydroxyethyl)-4-oxophthalazine-1-carboxylate |
| SMILES | Cc1cccc(COC(=O)c2nn(CCO)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-13-5-4-6-14(11-13)12-25-19(24)17-15-7-2-3-8-16(15)18(23)21(20-17)9-10-22/h2-8,11,22H,9-10,12H2,1H3 |
| InChIKey | VEANPCPNBKUKKC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |