C23H16ClF3N6O — CID 75578348
8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one (PubChem CID 75578348) has the molecular formula C23H16ClF3N6O and a molecular weight of 484.87 g/mol. Its IUPAC name is 8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one.
| Compound Name | 8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 75578348 |
| Molecular Formula | C23H16ClF3N6O |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]isoquinolin-1-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc2cccc(Cl)c2c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H16ClF3N6O/c1-12(32-21-19-20(29-10-28-19)30-11-31-21)17-8-13-4-2-7-16(24)18(13)22(34)33(17)15-6-3-5-14(9-15)23(25,26)27/h2-12H,1H3,(H2,28,29,30,31,32) |
| InChIKey | XYSGZJFIGLYHMG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |