C28H42O4 — CID 75579031
5-ethoxy-4-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxolan-2-one (PubChem CID 75579031) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is 5-ethoxy-4-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxolan-2-one.
| Compound Name | 5-ethoxy-4-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxolan-2-one |
|---|---|
| PubChem CID | 75579031 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 5-ethoxy-4-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)oxolan-2-one |
| SMILES | CCOC1OC(=O)CC1C1CCC2(C)C3=CCC4C(C)(C)C(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H42O4/c1-7-31-24-17(16-23(30)32-24)18-10-14-28(6)20-8-9-21-25(2,3)22(29)12-13-26(21,4)19(20)11-15-27(18,28)5/h8,17-19,21,24H,7,9-16H2,1-6H3 |
| InChIKey | NESJGVUWBFZDSX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|