C17H12BrNO4S — CID 75599495
5-[(3-bromo-4-hydroxyphenyl)methylidene]-3-(2-methoxyphenyl)-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 75599495) has the molecular formula C17H12BrNO4S and a molecular weight of 406.26 g/mol. Its IUPAC name is 5-[(3-bromo-4-hydroxyphenyl)methylidene]-3-(2-methoxyphenyl)-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | 5-[(3-bromo-4-hydroxyphenyl)methylidene]-3-(2-methoxyphenyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 75599495 |
| Molecular Formula | C17H12BrNO4S |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | 5-[(3-bromo-4-hydroxyphenyl)methylidene]-3-(2-methoxyphenyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | COc1ccccc1N1C(=O)C(=Cc2ccc(O)c(Br)c2)OC1=S |
| InChI | InChI=1S/C17H12BrNO4S/c1-22-14-5-3-2-4-12(14)19-16(21)15(23-17(19)24)9-10-6-7-13(20)11(18)8-10/h2-9,20H,1H3 |
| InChIKey | AGIUPEBSBDBNGH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|