C16H9BrFNO3S — CID 51002177
(5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-3-(4-fluorophenyl)-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 51002177) has the molecular formula C16H9BrFNO3S and a molecular weight of 394.22 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-3-(4-fluorophenyl)-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | (5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-3-(4-fluorophenyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 51002177 |
| Molecular Formula | C16H9BrFNO3S |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | (5E)-5-[(3-bromo-4-hydroxyphenyl)methylidene]-3-(4-fluorophenyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(O)c(Br)c2)OC(=S)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H9BrFNO3S/c17-12-7-9(1-6-13(12)20)8-14-15(21)19(16(23)22-14)11-4-2-10(18)3-5-11/h1-8,20H/b14-8+ |
| InChIKey | NWXDMACOVSQXDX-RIYZIHGNSA-N |
| XLogP | 3.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|